C24H24N2O2 — CID 18687411
2-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-4-phenylbenzamide (PubChem CID 18687411) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-4-phenylbenzamide.
| Compound Name | 2-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 18687411 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-methoxy-N-(2-methyl-3,4-dihydro-1H-isoquinolin-5-yl)-4-phenylbenzamide |
| SMILES | COc1cc(-c2ccccc2)ccc1C(=O)Nc1cccc2c1CCN(C)C2 |
| InChI | InChI=1S/C24H24N2O2/c1-26-14-13-20-19(16-26)9-6-10-22(20)25-24(27)21-12-11-18(15-23(21)28-2)17-7-4-3-5-8-17/h3-12,15H,13-14,16H2,1-2H3,(H,25,27) |
| InChIKey | HLUMUKOJUJIFDW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |