C40H43N5O5 — CID 18689594
2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[[4-(morpholine-4-carbonyl)phenyl]methyl]acetamide (PubChem CID 18689594) has the molecular formula C40H43N5O5 and a molecular weight of 673.81 g/mol. Its IUPAC name is 2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[[4-(morpholine-4-carbonyl)phenyl]methyl]acetamide.
| Compound Name | 2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[[4-(morpholine-4-carbonyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 18689594 |
| Molecular Formula | C40H43N5O5 |
| Molecular Weight | 673.81 g/mol |
| Exact Mass | 673.33 |
| IUPAC Name | 2-(4-cyanophenyl)-2-[3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-N-[[4-(morpholine-4-carbonyl)phenyl]methyl]acetamide |
| SMILES | N#Cc1ccc(C(C(=O)NCc2ccc(C(=O)N3CCOCC3)cc2)N2C(=O)C3Cc4ccccc4CN3C(=O)C2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C40H43N5O5/c41-24-28-10-14-30(15-11-28)36(37(46)42-25-29-12-16-31(17-13-29)38(47)43-18-20-50-21-19-43)45-35(22-27-6-2-1-3-7-27)39(48)44-26-33-9-5-4-8-32(33)23-34(44)40(45)49/h4-5,8-17,27,34-36H,1-3,6-7,18-23,25-26H2,(H,42,46) |
| InChIKey | QVKZHPAWZMARCA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 123.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |