C41H45N5O4 — CID 54130661
2-[(3S,11aS)-3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(4-isocyanophenyl)-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]acetamide (PubChem CID 54130661) has the molecular formula C41H45N5O4 and a molecular weight of 671.84 g/mol. Its IUPAC name is 2-[(3S,11aS)-3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(4-isocyanophenyl)-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(3S,11aS)-3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(4-isocyanophenyl)-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 54130661 |
| Molecular Formula | C41H45N5O4 |
| Molecular Weight | 671.84 g/mol |
| Exact Mass | 671.35 |
| IUPAC Name | 2-[(3S,11aS)-3-(cyclohexylmethyl)-1,4-dioxo-3,6,11,11a-tetrahydropyrazino[1,2-b]isoquinolin-2-yl]-2-(4-isocyanophenyl)-N-[[4-(piperidine-1-carbonyl)phenyl]methyl]acetamide |
| SMILES | [C-]#[N+]c1ccc(C(C(=O)NCc2ccc(C(=O)N3CCCCC3)cc2)N2C(=O)[C@@H]3Cc4ccccc4CN3C(=O)[C@@H]2CC2CCCCC2)cc1 |
| InChI | InChI=1S/C41H45N5O4/c1-42-34-20-18-30(19-21-34)37(38(47)43-26-29-14-16-31(17-15-29)39(48)44-22-8-3-9-23-44)46-36(24-28-10-4-2-5-11-28)40(49)45-27-33-13-7-6-12-32(33)25-35(45)41(46)50/h6-7,12-21,28,35-37H,2-5,8-11,22-27H2,(H,43,47)/t35-,36-,37?/m0/s1 |
| InChIKey | NUCVEWMYWQAEAX-JTTVYFNNSA-N |
| XLogP | 6.36 |
| TPSA | 94.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.84 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|