C8H15NO4 — CID 18690231
N-(1,2,2-trimethoxyethyl)prop-2-enamide (PubChem CID 18690231) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-(1,2,2-trimethoxyethyl)prop-2-enamide.
| Compound Name | N-(1,2,2-trimethoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 18690231 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-(1,2,2-trimethoxyethyl)prop-2-enamide |
| SMILES | C=CC(=O)NC(OC)C(OC)OC |
| InChI | InChI=1S/C8H15NO4/c1-5-6(10)9-7(11-2)8(12-3)13-4/h5,7-8H,1H2,2-4H3,(H,9,10) |
| InChIKey | KAEIFTQQDBDXIW-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|