C15H22O4S — CID 18691612
methyl 4-(2,2-diethoxyethylsulfanyl)-2-methylbenzoate (PubChem CID 18691612) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is methyl 4-(2,2-diethoxyethylsulfanyl)-2-methylbenzoate.
| Compound Name | methyl 4-(2,2-diethoxyethylsulfanyl)-2-methylbenzoate |
|---|---|
| PubChem CID | 18691612 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | methyl 4-(2,2-diethoxyethylsulfanyl)-2-methylbenzoate |
| SMILES | CCOC(CSc1ccc(C(=O)OC)c(C)c1)OCC |
| InChI | InChI=1S/C15H22O4S/c1-5-18-14(19-6-2)10-20-12-7-8-13(11(3)9-12)15(16)17-4/h7-9,14H,5-6,10H2,1-4H3 |
| InChIKey | HAOJHLLGFKNJCF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|