C15H21FO4S2 — CID 22666313
methyl 4-(2,2-diethoxyethylsulfanyl)-2-fluoro-3-methylsulfanylbenzoate (PubChem CID 22666313) has the molecular formula C15H21FO4S2 and a molecular weight of 348.46 g/mol. Its IUPAC name is methyl 4-(2,2-diethoxyethylsulfanyl)-2-fluoro-3-methylsulfanylbenzoate.
| Compound Name | methyl 4-(2,2-diethoxyethylsulfanyl)-2-fluoro-3-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 22666313 |
| Molecular Formula | C15H21FO4S2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 4-(2,2-diethoxyethylsulfanyl)-2-fluoro-3-methylsulfanylbenzoate |
| SMILES | CCOC(CSc1ccc(C(=O)OC)c(F)c1SC)OCC |
| InChI | InChI=1S/C15H21FO4S2/c1-5-19-12(20-6-2)9-22-11-8-7-10(15(17)18-3)13(16)14(11)21-4/h7-8,12H,5-6,9H2,1-4H3 |
| InChIKey | VIYXVMATOMDCJW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|