C21H19F5O7 — CID 58701876
methyl 2-(diethoxymethyl)-4-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzoate (PubChem CID 58701876) has the molecular formula C21H19F5O7 and a molecular weight of 479.36 g/mol. Its IUPAC name is methyl 2-(diethoxymethyl)-4-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzoate.
| Compound Name | methyl 2-(diethoxymethyl)-4-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 58701876 |
| Molecular Formula | C21H19F5O7 |
| Molecular Weight | 479.36 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | methyl 2-(diethoxymethyl)-4-[2-oxo-2-(2,3,4,5,6-pentafluorophenoxy)ethoxy]benzoate |
| SMILES | CCOC(OCC)c1cc(OCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)ccc1[13C](=O)OC |
| InChI | InChI=1S/C21H19F5O7/c1-4-30-21(31-5-2)12-8-10(6-7-11(12)20(28)29-3)32-9-13(27)33-19-17(25)15(23)14(22)16(24)18(19)26/h6-8,21H,4-5,9H2,1-3H3/i20+1 |
| InChIKey | PYQLTEULJZPNQI-UUZXFVOJSA-N |
| XLogP | 4.22 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|