C17H14N4O6S — CID 18694061
14-[2-(methanesulfonamido)-2-oxoethyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid (PubChem CID 18694061) has the molecular formula C17H14N4O6S and a molecular weight of 402.39 g/mol. Its IUPAC name is 14-[2-(methanesulfonamido)-2-oxoethyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid.
| Compound Name | 14-[2-(methanesulfonamido)-2-oxoethyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 18694061 |
| Molecular Formula | C17H14N4O6S |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 14-[2-(methanesulfonamido)-2-oxoethyl]-7-oxo-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10,12,14-hexaene-4-carboxylic acid |
| SMILES | CS(=O)(=O)NC(=O)Cc1cccc2c1Cc1c-2[nH]c(=O)c2nc(C(=O)O)cn12 |
| InChI | InChI=1S/C17H14N4O6S/c1-28(26,27)20-13(22)5-8-3-2-4-9-10(8)6-12-14(9)19-16(23)15-18-11(17(24)25)7-21(12)15/h2-4,7H,5-6H2,1H3,(H,19,23)(H,20,22)(H,24,25) |
| InChIKey | LCFDJNKUPFJKOF-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |