C17H21ClN4O — CID 18694196
N'-(6-chloropyridazin-3-yl)-N-(3,4-dihydro-2H-chromen-2-ylmethyl)propane-1,3-diamine (PubChem CID 18694196) has the molecular formula C17H21ClN4O and a molecular weight of 332.84 g/mol. Its IUPAC name is N'-(6-chloropyridazin-3-yl)-N-(3,4-dihydro-2H-chromen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-(6-chloropyridazin-3-yl)-N-(3,4-dihydro-2H-chromen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 18694196 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.84 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N'-(6-chloropyridazin-3-yl)-N-(3,4-dihydro-2H-chromen-2-ylmethyl)propane-1,3-diamine |
| SMILES | Clc1ccc(NCCCNCC2CCc3ccccc3O2)nn1 |
| InChI | InChI=1S/C17H21ClN4O/c18-16-8-9-17(22-21-16)20-11-3-10-19-12-14-7-6-13-4-1-2-5-15(13)23-14/h1-2,4-5,8-9,14,19H,3,6-7,10-12H2,(H,20,22) |
| InChIKey | UOBLDBABGSURQG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|