About (3-hydroxy-2-oxopropyl) acetate
(3-hydroxy-2-oxopropyl) acetate (PubChem CID 18702505) has the molecular formula C5H8O4
and a molecular weight of 132.12 g/mol. Its IUPAC name is (3-hydroxy-2-oxopropyl) acetate.
Molecular Properties
| Compound Name | (3-hydroxy-2-oxopropyl) acetate |
| PubChem CID | 18702505 |
| Molecular Formula | C5H8O4 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.04 |
| IUPAC Name | (3-hydroxy-2-oxopropyl) acetate |
| SMILES | CC(=O)OCC(=O)CO |
| InChI | InChI=1S/C5H8O4/c1-4(7)9-3-5(8)2-6/h6H,2-3H2,1H3 |
| InChIKey | HZGOSCXYXUNZRW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-hydroxy-2-oxopropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxy-2-oxopropyl) acetate?
The IUPAC name of (3-hydroxy-2-oxopropyl) acetate (CID 18702505) is (3-hydroxy-2-oxopropyl) acetate.
What is the SMILES notation for (3-hydroxy-2-oxopropyl) acetate?
The canonical SMILES for (3-hydroxy-2-oxopropyl) acetate is CC(=O)OCC(=O)CO.
What is the InChIKey of (3-hydroxy-2-oxopropyl) acetate?
The InChIKey is HZGOSCXYXUNZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4/c1-4(7)9-3-5(8)2-6/h6H,2-3H2,1H3.
What are the key properties of (3-hydroxy-2-oxopropyl) acetate?
(3-hydroxy-2-oxopropyl) acetate has a molecular weight of 132.12 g/mol, XLogP of -0.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxy-2-oxopropyl) acetate is sourced from PubChem (CID 18702505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).