C30H27N3O3 — CID 18705060
4-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1-phenyl-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile (PubChem CID 18705060) has the molecular formula C30H27N3O3 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1-phenyl-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile.
| Compound Name | 4-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1-phenyl-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 18705060 |
| Molecular Formula | C30H27N3O3 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-ylmethyl)-3-oxo-1-phenyl-1,3a,4,6,7,8,8a,8b-octahydropyrrolo[3,4-a]pyrrolizin-4-yl]benzonitrile |
| SMILES | N#Cc1ccc(C2C3C(=O)N(Cc4ccc5c(c4)OCO5)C(c4ccccc4)C3C3CCCN32)cc1 |
| InChI | InChI=1S/C30H27N3O3/c31-16-19-8-11-22(12-9-19)29-27-26(23-7-4-14-32(23)29)28(21-5-2-1-3-6-21)33(30(27)34)17-20-10-13-24-25(15-20)36-18-35-24/h1-3,5-6,8-13,15,23,26-29H,4,7,14,17-18H2 |
| InChIKey | KLTZBVFKJQDDSB-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |