C26H32N2O4 — CID 18705833
2-[(3,4-dimethoxyphenyl)methyl]-6-(dipropylamino)-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione (PubChem CID 18705833) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-6-(dipropylamino)-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-6-(dipropylamino)-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18705833 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-6-(dipropylamino)-6,7-dihydro-5H-cyclopenta[f]isoindole-1,3-dione |
| SMILES | CCCN(CCC)C1Cc2cc3c(cc2C1)C(=O)N(Cc1ccc(OC)c(OC)c1)C3=O |
| InChI | InChI=1S/C26H32N2O4/c1-5-9-27(10-6-2)20-12-18-14-21-22(15-19(18)13-20)26(30)28(25(21)29)16-17-7-8-23(31-3)24(11-17)32-4/h7-8,11,14-15,20H,5-6,9-10,12-13,16H2,1-4H3 |
| InChIKey | NQPXBQOKXLEICY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|