C20H20N2O4 — CID 3237226
N-(1,3-benzodioxol-5-ylmethyl)-3-oxo-2-propylisoindoline-4-carboxamide (PubChem CID 3237226) has the molecular formula C20H20N2O4 and a molecular weight of 352.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-oxo-2-propyl-1H-isoindole-4-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-oxo-2-propylisoindoline-4-carboxamide |
|---|---|
| PubChem CID | 3237226 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-oxo-2-propyl-1H-isoindole-4-carboxamide |
| SMILES | CCCN1CC2=C(C1=O)C(=CC=C2)C(=O)NCC3=CC4=C(C=C3)OCO4 |
| InChI | InChI=1S/C20H20N2O4/c1-2-8-22-11-14-4-3-5-15(18(14)20(22)24)19(23)21-10-13-6-7-16-17(9-13)26-12-25-16/h3-7,9H,2,8,10-12H2,1H3,(H,21,23) |
| InChIKey | MYAPBPMHUFNXOP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | 540 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |