About 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole
2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole (PubChem CID 18707717) has the molecular formula C6H5N3S3
and a molecular weight of 215.33 g/mol. Its IUPAC name is 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole |
| PubChem CID | 18707717 |
| Molecular Formula | C6H5N3S3 |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole |
| SMILES | Cc1nnc(Sc2nccs2)s1 |
| InChI | InChI=1S/C6H5N3S3/c1-4-8-9-6(11-4)12-5-7-2-3-10-5/h2-3H,1H3 |
| InChIKey | ZZEJHROJISEZEM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole?
The IUPAC name of 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole (CID 18707717) is 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole.
What is the SMILES notation for 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole?
The canonical SMILES for 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole is Cc1nnc(Sc2nccs2)s1.
What is the InChIKey of 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole?
The InChIKey is ZZEJHROJISEZEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S3/c1-4-8-9-6(11-4)12-5-7-2-3-10-5/h2-3H,1H3.
What are the key properties of 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole?
2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole has a molecular weight of 215.33 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole is sourced from PubChem (CID 18707717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).