C6H5N3S3 — CID 18707717
2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole (PubChem CID 18707717) has the molecular formula C6H5N3S3 and a molecular weight of 215.33 g/mol. Its IUPAC name is 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole.
| Compound Name | 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 18707717 |
| Molecular Formula | C6H5N3S3 |
| Molecular Weight | 215.33 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 2-methyl-5-(1,3-thiazol-2-ylsulfanyl)-1,3,4-thiadiazole |
| SMILES | Cc1nnc(Sc2nccs2)s1 |
| InChI | InChI=1S/C6H5N3S3/c1-4-8-9-6(11-4)12-5-7-2-3-10-5/h2-3H,1H3 |
| InChIKey | ZZEJHROJISEZEM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|