C8H19N2OP — CID 18709506
N-ethyl-2-methyl-4-(methylamino)-3-phosphanylbutanamide (PubChem CID 18709506) has the molecular formula C8H19N2OP and a molecular weight of 190.23 g/mol. Its IUPAC name is N-ethyl-2-methyl-4-(methylamino)-3-phosphanylbutanamide.
| Compound Name | N-ethyl-2-methyl-4-(methylamino)-3-phosphanylbutanamide |
|---|---|
| PubChem CID | 18709506 |
| Molecular Formula | C8H19N2OP |
| Molecular Weight | 190.23 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | N-ethyl-2-methyl-4-(methylamino)-3-phosphanylbutanamide |
| SMILES | CCNC(=O)C(C)C(P)CNC |
| InChI | InChI=1S/C8H19N2OP/c1-4-10-8(11)6(2)7(12)5-9-3/h6-7,9H,4-5,12H2,1-3H3,(H,10,11) |
| InChIKey | OENXMGVJHISZDC-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.23 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|