C11H24N2O3S — CID 18709904
(2R)-2-amino-2-[2-(butylsulfonimidoyl)ethyl]-3-methylbutanoic acid (PubChem CID 18709904) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-(butylsulfonimidoyl)ethyl]-3-methylbutanoic acid.
| Compound Name | (2R)-2-amino-2-[2-(butylsulfonimidoyl)ethyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18709904 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (2R)-2-amino-2-[2-(butylsulfonimidoyl)ethyl]-3-methylbutanoic acid |
| SMILES | [H]N=S(=O)(CCCC)CC[C@](N)(C(=O)O)C(C)C |
| InChI | InChI=1S/C11H24N2O3S/c1-4-5-7-17(13,16)8-6-11(12,9(2)3)10(14)15/h9,13H,4-8,12H2,1-3H3,(H,14,15)/t11-,17?/m1/s1 |
| InChIKey | CISLQXBENZUJQP-VCQTYVLVSA-N |
| XLogP | 1.66 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |