C10H22N2O3S — CID 18709907
(2S)-2-amino-4-(butylsulfonimidoyl)-2-ethylbutanoic acid (PubChem CID 18709907) has the molecular formula C10H22N2O3S and a molecular weight of 250.36 g/mol. Its IUPAC name is (2S)-2-amino-4-(butylsulfonimidoyl)-2-ethylbutanoic acid.
| Compound Name | (2S)-2-amino-4-(butylsulfonimidoyl)-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 18709907 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | (2S)-2-amino-4-(butylsulfonimidoyl)-2-ethylbutanoic acid |
| SMILES | [H]N=S(=O)(CCCC)CC[C@@](N)(CC)C(=O)O |
| InChI | InChI=1S/C10H22N2O3S/c1-3-5-7-16(12,15)8-6-10(11,4-2)9(13)14/h12H,3-8,11H2,1-2H3,(H,13,14)/t10-,16?/m0/s1 |
| InChIKey | NKSRTAWWMQLVBR-VQVVDHBBSA-N |
| XLogP | 1.42 |
| TPSA | 104.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |