C18H24F3NO2 — CID 18709944
2,2,4-trimethyl-3-prop-2-enoxy-N-[4-(trifluoromethyl)phenyl]pentanamide (PubChem CID 18709944) has the molecular formula C18H24F3NO2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 2,2,4-trimethyl-3-prop-2-enoxy-N-[4-(trifluoromethyl)phenyl]pentanamide.
| Compound Name | 2,2,4-trimethyl-3-prop-2-enoxy-N-[4-(trifluoromethyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 18709944 |
| Molecular Formula | C18H24F3NO2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2,2,4-trimethyl-3-prop-2-enoxy-N-[4-(trifluoromethyl)phenyl]pentanamide |
| SMILES | C=CCOC(C(C)C)C(C)(C)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO2/c1-6-11-24-15(12(2)3)17(4,5)16(23)22-14-9-7-13(8-10-14)18(19,20)21/h6-10,12,15H,1,11H2,2-5H3,(H,22,23) |
| InChIKey | GWSDPPRONJNAAH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|