C13H20N4O5 — CID 18712631
tert-butyl 4-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carbonyl)piperazine-1-carboxylate (PubChem CID 18712631) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is tert-butyl 4-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carbonyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carbonyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 18712631 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | tert-butyl 4-(4-methyl-5-oxido-1,2,5-oxadiazol-5-ium-3-carbonyl)piperazine-1-carboxylate |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)no[n+]1[O-] |
| InChI | InChI=1S/C13H20N4O5/c1-9-10(14-22-17(9)20)11(18)15-5-7-16(8-6-15)12(19)21-13(2,3)4/h5-8H2,1-4H3 |
| InChIKey | UUYAKCPCVOPRGR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 102.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|