C19H24ClN5O3 — CID 46857942
tert-butyl 4-[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]piperazine-1-carboxylate (PubChem CID 46857942) has the molecular formula C19H24ClN5O3 and a molecular weight of 405.89 g/mol. Its IUPAC name is tert-butyl 4-[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46857942 |
| Molecular Formula | C19H24ClN5O3 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | tert-butyl 4-[1-(4-chlorophenyl)-5-methyltriazole-4-carbonyl]piperazine-1-carboxylate |
| SMILES | Cc1c(C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)nnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN5O3/c1-13-16(21-22-25(13)15-7-5-14(20)6-8-15)17(26)23-9-11-24(12-10-23)18(27)28-19(2,3)4/h5-8H,9-12H2,1-4H3 |
| InChIKey | IJFLHOWDKPJHCU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |