C11H15NO5S — CID 18712765
N,2-dihydroxy-2-methyl-3-(4-methylphenyl)sulfonylpropanamide (PubChem CID 18712765) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is N,2-dihydroxy-2-methyl-3-(4-methylphenyl)sulfonylpropanamide.
| Compound Name | N,2-dihydroxy-2-methyl-3-(4-methylphenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 18712765 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N,2-dihydroxy-2-methyl-3-(4-methylphenyl)sulfonylpropanamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(C)(O)C(=O)NO)cc1 |
| InChI | InChI=1S/C11H15NO5S/c1-8-3-5-9(6-4-8)18(16,17)7-11(2,14)10(13)12-15/h3-6,14-15H,7H2,1-2H3,(H,12,13) |
| InChIKey | RXTXUBHJVQLJOV-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|