C20H31NO4S — CID 18713877
2-[4-[4-[1-(propan-2-ylsulfonylamino)propan-2-yl]cyclohexyl]phenyl]acetic acid (PubChem CID 18713877) has the molecular formula C20H31NO4S and a molecular weight of 381.54 g/mol. Its IUPAC name is 2-[4-[4-[1-(propan-2-ylsulfonylamino)propan-2-yl]cyclohexyl]phenyl]acetic acid.
| Compound Name | 2-[4-[4-[1-(propan-2-ylsulfonylamino)propan-2-yl]cyclohexyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 18713877 |
| Molecular Formula | C20H31NO4S |
| Molecular Weight | 381.54 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-[4-[4-[1-(propan-2-ylsulfonylamino)propan-2-yl]cyclohexyl]phenyl]acetic acid |
| SMILES | CC(CNS(=O)(=O)C(C)C)C1CCC(c2ccc(CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C20H31NO4S/c1-14(2)26(24,25)21-13-15(3)17-8-10-19(11-9-17)18-6-4-16(5-7-18)12-20(22)23/h4-7,14-15,17,19,21H,8-13H2,1-3H3,(H,22,23) |
| InChIKey | PNNQJEHRFGESBW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |