C19H23N3O5S — CID 18714975
N-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfonyl-3,4-dihydro-2H-quinoxaline-2-carboxamide (PubChem CID 18714975) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is N-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfonyl-3,4-dihydro-2H-quinoxaline-2-carboxamide.
| Compound Name | N-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfonyl-3,4-dihydro-2H-quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 18714975 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | N-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]sulfonyl-3,4-dihydro-2H-quinoxaline-2-carboxamide |
| SMILES | CC(C)(C)Oc1ccc(S(=O)(=O)N2c3ccccc3NCC2C(=O)NO)cc1 |
| InChI | InChI=1S/C19H23N3O5S/c1-19(2,3)27-13-8-10-14(11-9-13)28(25,26)22-16-7-5-4-6-15(16)20-12-17(22)18(23)21-24/h4-11,17,20,24H,12H2,1-3H3,(H,21,23) |
| InChIKey | ZCRJZJDMPRGXAT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|