C28H33N4O2+ — CID 18715321
2-(1-hydroxypyridin-1-ium-3-yl)-2-methyl-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]propan-1-one (PubChem CID 18715321) has the molecular formula C28H33N4O2+ and a molecular weight of 457.60 g/mol. Its IUPAC name is 2-(1-hydroxypyridin-1-ium-3-yl)-2-methyl-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-(1-hydroxypyridin-1-ium-3-yl)-2-methyl-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 18715321 |
| Molecular Formula | C28H33N4O2+ |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 2-(1-hydroxypyridin-1-ium-3-yl)-2-methyl-1-[4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1ccc2c(c1)CCc1cccnc1C2N1CCN(C(=O)C(C)(C)c2ccc[n+](O)c2)CC1 |
| InChI | InChI=1S/C28H33N4O2/c1-20-8-11-24-22(18-20)10-9-21-6-4-12-29-25(21)26(24)30-14-16-31(17-15-30)27(33)28(2,3)23-7-5-13-32(34)19-23/h4-8,11-13,18-19,26,34H,9-10,14-17H2,1-3H3/q+1 |
| InChIKey | VDPIJYYRYXTKQW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|