C25H27N5O — CID 18715326
4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-3-ylpiperazine-1-carboxamide (PubChem CID 18715326) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-3-ylpiperazine-1-carboxamide.
| Compound Name | 4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-3-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 18715326 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 4-(13-methyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-3-ylpiperazine-1-carboxamide |
| SMILES | Cc1ccc2c(c1)CCc1cccnc1C2N1CCN(C(=O)Nc2cccnc2)CC1 |
| InChI | InChI=1S/C25H27N5O/c1-18-6-9-22-20(16-18)8-7-19-4-2-11-27-23(19)24(22)29-12-14-30(15-13-29)25(31)28-21-5-3-10-26-17-21/h2-6,9-11,16-17,24H,7-8,12-15H2,1H3,(H,28,31) |
| InChIKey | RSXCEJSOIHNGHB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |