C24H24ClN5O — CID 10550770
4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-4-ylpiperazine-1-carboxamide (PubChem CID 10550770) has the molecular formula C24H24ClN5O and a molecular weight of 433.94 g/mol. Its IUPAC name is 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-4-ylpiperazine-1-carboxamide.
| Compound Name | 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-4-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 10550770 |
| Molecular Formula | C24H24ClN5O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)-N-pyridin-4-ylpiperazine-1-carboxamide |
| SMILES | O=C(Nc1ccncc1)N1CCN(C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C24H24ClN5O/c25-19-5-6-21-18(16-19)4-3-17-2-1-9-27-22(17)23(21)29-12-14-30(15-13-29)24(31)28-20-7-10-26-11-8-20/h1-2,5-11,16,23H,3-4,12-15H2,(H,26,28,31) |
| InChIKey | VEXCGIFLHBOFMT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |