C20H22ClN3O — CID 59880888
1-[(2R)-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-2-yl]ethanone (PubChem CID 59880888) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 1-[(2R)-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-2-yl]ethanone.
| Compound Name | 1-[(2R)-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 59880888 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[(2R)-4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)piperazin-2-yl]ethanone |
| SMILES | CC(=O)[C@H]1CN(C2c3ccc(Cl)cc3CCc3cccnc32)CCN1 |
| InChI | InChI=1S/C20H22ClN3O/c1-13(25)18-12-24(10-9-22-18)20-17-7-6-16(21)11-15(17)5-4-14-3-2-8-23-19(14)20/h2-3,6-8,11,18,20,22H,4-5,9-10,12H2,1H3/t18-,20?/m1/s1 |
| InChIKey | NVCQFFGBCAMKAO-QSVWIEALSA-N |
| XLogP | 2.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |