C21H24ClN3O — CID 59880675
1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone (PubChem CID 59880675) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone.
| Compound Name | 1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone |
|---|---|
| PubChem CID | 59880675 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 1-[4-[(2R)-13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl]-1-methylpiperazin-2-yl]ethanone |
| SMILES | CC(=O)C1CN([C@@H]2c3ccc(Cl)cc3CCc3cccnc32)CCN1C |
| InChI | InChI=1S/C21H24ClN3O/c1-14(26)19-13-25(11-10-24(19)2)21-18-8-7-17(22)12-16(18)6-5-15-4-3-9-23-20(15)21/h3-4,7-9,12,19,21H,5-6,10-11,13H2,1-2H3/t19?,21-/m1/s1 |
| InChIKey | NGOVVEWEOBAEFX-VGAJERRHSA-N |
| XLogP | 3.13 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |