C30H31ClN2O2S — CID 18715448
1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-3-(methyl-methylidene-oxo-λ6-sulfanyl)-2-phenylpropan-1-one (PubChem CID 18715448) has the molecular formula C30H31ClN2O2S and a molecular weight of 519.11 g/mol. Its IUPAC name is 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-3-(methyl-methylidene-oxo-λ6-sulfanyl)-2-phenylpropan-1-one.
| Compound Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-3-(methyl-methylidene-oxo-λ6-sulfanyl)-2-phenylpropan-1-one |
|---|---|
| PubChem CID | 18715448 |
| Molecular Formula | C30H31ClN2O2S |
| Molecular Weight | 519.11 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]-3-(methyl-methylidene-oxo-λ6-sulfanyl)-2-phenylpropan-1-one |
| SMILES | C=S(C)(=O)CC(C(=O)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1)c1ccccc1 |
| InChI | InChI=1S/C30H31ClN2O2S/c1-36(2,35)20-27(21-7-4-3-5-8-21)30(34)33-17-14-22(15-18-33)28-26-13-12-25(31)19-24(26)11-10-23-9-6-16-32-29(23)28/h3-9,12-13,16,19,27H,1,10-11,14-15,17-18,20H2,2H3 |
| InChIKey | DWEDIRPNOGOOPU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.11 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|