C12H20 — CID 18715970
2,3-dimethyl-1,2,3,4,4a,5,8,8a-octahydronaphthalene (PubChem CID 18715970) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 2,3-dimethyl-1,2,3,4,4a,5,8,8a-octahydronaphthalene.
| Compound Name | 2,3-dimethyl-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 18715970 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 2,3-dimethyl-1,2,3,4,4a,5,8,8a-octahydronaphthalene |
| SMILES | CC1CC2CC=CCC2CC1C |
| InChI | InChI=1S/C12H20/c1-9-7-11-5-3-4-6-12(11)8-10(9)2/h3-4,9-12H,5-8H2,1-2H3 |
| InChIKey | MERJPGYKGRUPDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|