C45H59FO10 — CID 18716243
20-[2-(4-fluorophenyl)-2-hydroxyethyl]-14,21-dimethyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one (PubChem CID 18716243) has the molecular formula C45H59FO10 and a molecular weight of 778.95 g/mol. Its IUPAC name is 20-[2-(4-fluorophenyl)-2-hydroxyethyl]-14,21-dimethyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one.
| Compound Name | 20-[2-(4-fluorophenyl)-2-hydroxyethyl]-14,21-dimethyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
|---|---|
| PubChem CID | 18716243 |
| Molecular Formula | C45H59FO10 |
| Molecular Weight | 778.95 g/mol |
| Exact Mass | 778.41 |
| IUPAC Name | 20-[2-(4-fluorophenyl)-2-hydroxyethyl]-14,21-dimethyl-8,15-dimethylidene-2,19,30,34,37,39,40,41-octaoxanonacyclo[24.9.2.13,32.13,33.16,9.112,16.018,22.029,36.031,35]hentetracontan-24-one |
| SMILES | C=C1CC2CCC34CC5OC6C(OC7CCC(CC(=O)CC8C(CC9OC(CCC1O2)CC(C)C9=C)OC(CC(O)c1ccc(F)cc1)C8C)OC7C6O3)C5O4 |
| InChI | InChI=1S/C45H59FO10/c1-22-15-29-9-11-34-23(2)16-31(49-34)13-14-45-21-39-41(55-45)42-43(54-39)44(56-45)40-35(53-42)12-10-30(51-40)17-28(47)18-32-25(4)36(52-38(32)20-37(50-29)24(22)3)19-33(48)26-5-7-27(46)8-6-26/h5-8,22,25,29-44,48H,2-3,9-21H2,1,4H3 |
| InChIKey | GBLSLADZAXPTQF-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.95 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|