About 1-methyliminopentane-2,4-dione
1-methyliminopentane-2,4-dione (PubChem CID 18716504) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is 1-methyliminopentane-2,4-dione.
Molecular Properties
| Compound Name | 1-methyliminopentane-2,4-dione |
| PubChem CID | 18716504 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | 1-methyliminopentane-2,4-dione |
| SMILES | C/N=C/C(=O)CC(C)=O |
| InChI | InChI=1S/C6H9NO2/c1-5(8)3-6(9)4-7-2/h4H,3H2,1-2H3/b7-4+ |
| InChIKey | KMKOBJMJRMPZKQ-QPJJXVBHSA-N |
| XLogP | 0.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyliminopentane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyliminopentane-2,4-dione?
The IUPAC name of 1-methyliminopentane-2,4-dione (CID 18716504) is 1-methyliminopentane-2,4-dione.
What is the SMILES notation for 1-methyliminopentane-2,4-dione?
The canonical SMILES for 1-methyliminopentane-2,4-dione is C/N=C/C(=O)CC(C)=O.
What is the InChIKey of 1-methyliminopentane-2,4-dione?
The InChIKey is KMKOBJMJRMPZKQ-QPJJXVBHSA-N. The full InChI is InChI=1S/C6H9NO2/c1-5(8)3-6(9)4-7-2/h4H,3H2,1-2H3/b7-4+.
What are the key properties of 1-methyliminopentane-2,4-dione?
1-methyliminopentane-2,4-dione has a molecular weight of 127.14 g/mol, XLogP of 0.24, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyliminopentane-2,4-dione is sourced from PubChem (CID 18716504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).