C69H63N3O3 — CID 18716616
N-[4-[3,5-bis[4-(N-(4-ethoxyphenyl)-4-methylanilino)phenyl]phenyl]phenyl]-N-(4-ethoxyphenyl)-4-methylaniline (PubChem CID 18716616) has the molecular formula C69H63N3O3 and a molecular weight of 982.28 g/mol. Its IUPAC name is N-[4-[3,5-bis[4-(N-(4-ethoxyphenyl)-4-methylanilino)phenyl]phenyl]phenyl]-N-(4-ethoxyphenyl)-4-methylaniline.
| Compound Name | N-[4-[3,5-bis[4-(N-(4-ethoxyphenyl)-4-methylanilino)phenyl]phenyl]phenyl]-N-(4-ethoxyphenyl)-4-methylaniline |
|---|---|
| PubChem CID | 18716616 |
| Molecular Formula | C69H63N3O3 |
| Molecular Weight | 982.28 g/mol |
| Exact Mass | 981.49 |
| IUPAC Name | N-[4-[3,5-bis[4-(N-(4-ethoxyphenyl)-4-methylanilino)phenyl]phenyl]phenyl]-N-(4-ethoxyphenyl)-4-methylaniline |
| SMILES | CCOc1ccc(N(c2ccc(C)cc2)c2ccc(-c3cc(-c4ccc(N(c5ccc(C)cc5)c5ccc(OCC)cc5)cc4)cc(-c4ccc(N(c5ccc(C)cc5)c5ccc(OCC)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C69H63N3O3/c1-7-73-67-40-34-64(35-41-67)70(58-22-10-49(4)11-23-58)61-28-16-52(17-29-61)55-46-56(53-18-30-62(31-19-53)71(59-24-12-50(5)13-25-59)65-36-42-68(43-37-65)74-8-2)48-57(47-55)54-20-32-63(33-21-54)72(60-26-14-51(6)15-27-60)66-38-44-69(45-39-66)75-9-3/h10-48H,7-9H2,1-6H3 |
| InChIKey | LWCGAEKYLJYSBD-UHFFFAOYSA-N |
| XLogP | 19.22 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.28 |
| LogP ≤ 5 | 19.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |