C15H18ClN3O5S — CID 18717445
[2-(5-chloro-3,6-dimethyl-2-pyridinyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl] methanesulfonate (PubChem CID 18717445) has the molecular formula C15H18ClN3O5S and a molecular weight of 387.85 g/mol. Its IUPAC name is [2-(5-chloro-3,6-dimethyl-2-pyridinyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl] methanesulfonate.
| Compound Name | [2-(5-chloro-3,6-dimethyl-2-pyridinyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 18717445 |
| Molecular Formula | C15H18ClN3O5S |
| Molecular Weight | 387.85 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | [2-(5-chloro-3,6-dimethyl-2-pyridinyl)-1,3-dioxo-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridin-7-yl] methanesulfonate |
| SMILES | Cc1cc(Cl)c(C)nc1N1C(=O)C2CC(OS(C)(=O)=O)CCN2C1=O |
| InChI | InChI=1S/C15H18ClN3O5S/c1-8-6-11(16)9(2)17-13(8)19-14(20)12-7-10(24-25(3,22)23)4-5-18(12)15(19)21/h6,10,12H,4-5,7H2,1-3H3 |
| InChIKey | IAPJYRDTCFUESG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.85 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|