C15H17ClN4O2 — CID 18731717
2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-methylidene-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a]diazepine-1,3-dione (PubChem CID 18731717) has the molecular formula C15H17ClN4O2 and a molecular weight of 320.78 g/mol. Its IUPAC name is 2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-methylidene-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a]diazepine-1,3-dione.
| Compound Name | 2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-methylidene-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a]diazepine-1,3-dione |
|---|---|
| PubChem CID | 18731717 |
| Molecular Formula | C15H17ClN4O2 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(5-chloro-3,6-dimethyl-2-pyridinyl)-7-methylidene-5,6,8,9-tetrahydro-[1,2,4]triazolo[1,2-a]diazepine-1,3-dione |
| SMILES | C=C1CCn2c(=O)n(-c3nc(C)c(Cl)cc3C)c(=O)n2CC1 |
| InChI | InChI=1S/C15H17ClN4O2/c1-9-4-6-18-14(21)20(15(22)19(18)7-5-9)13-10(2)8-12(16)11(3)17-13/h8H,1,4-7H2,2-3H3 |
| InChIKey | PQRIEQNZFMNHOA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|