C19H21ClN2O — CID 56570338
[2-chloro-5-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-methylidenepiperidin-1-yl)methanone (PubChem CID 56570338) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is [2-chloro-5-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-methylidenepiperidin-1-yl)methanone.
| Compound Name | [2-chloro-5-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-methylidenepiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 56570338 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [2-chloro-5-(2,5-dimethylpyrrol-1-yl)phenyl]-(4-methylidenepiperidin-1-yl)methanone |
| SMILES | C=C1CCN(C(=O)c2cc(-n3c(C)ccc3C)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H21ClN2O/c1-13-8-10-21(11-9-13)19(23)17-12-16(6-7-18(17)20)22-14(2)4-5-15(22)3/h4-7,12H,1,8-11H2,2-3H3 |
| InChIKey | FAWHTTQNJKPERH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|