C18H17ClN2O3 — CID 75413588
(5-methyl-1,2-oxazol-3-yl)methyl 2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 75413588) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl)methyl 2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl)methyl 2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 75413588 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl)methyl 2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1cc(COC(=O)c2cc(-n3c(C)ccc3C)ccc2Cl)no1 |
| InChI | InChI=1S/C18H17ClN2O3/c1-11-4-5-12(2)21(11)15-6-7-17(19)16(9-15)18(22)23-10-14-8-13(3)24-20-14/h4-9H,10H2,1-3H3 |
| InChIKey | DTOQAMMRERRTSN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|