C17H17ClN4O — CID 24627356
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-(1-methylpyrazol-3-yl)benzamide (PubChem CID 24627356) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-(1-methylpyrazol-3-yl)benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-(1-methylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 24627356 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-(1-methylpyrazol-3-yl)benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(Cl)c(C(=O)Nc2ccn(C)n2)c1 |
| InChI | InChI=1S/C17H17ClN4O/c1-11-4-5-12(2)22(11)13-6-7-15(18)14(10-13)17(23)19-16-8-9-21(3)20-16/h4-10H,1-3H3,(H,19,20,23) |
| InChIKey | BCBBSJJKUFIZBY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|