C22H22ClN3O3 — CID 35335874
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-[(2-methoxyacetyl)amino]phenyl]benzamide (PubChem CID 35335874) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-[(2-methoxyacetyl)amino]phenyl]benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-[(2-methoxyacetyl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 35335874 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-[(2-methoxyacetyl)amino]phenyl]benzamide |
| SMILES | COCC(=O)Nc1ccc(NC(=O)c2cc(-n3c(C)ccc3C)ccc2Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-14-4-5-15(2)26(14)18-10-11-20(23)19(12-18)22(28)25-17-8-6-16(7-9-17)24-21(27)13-29-3/h4-12H,13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | ODKGYVWUITVDKR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|