C26H24ClN3O3 — CID 33126560
2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]benzamide (PubChem CID 33126560) has the molecular formula C26H24ClN3O3 and a molecular weight of 461.95 g/mol. Its IUPAC name is 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]benzamide.
| Compound Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 33126560 |
| Molecular Formula | C26H24ClN3O3 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 2-chloro-5-(2,5-dimethylpyrrol-1-yl)-N-[4-methoxy-3-(pyridin-4-ylmethoxy)phenyl]benzamide |
| SMILES | COc1ccc(NC(=O)c2cc(-n3c(C)ccc3C)ccc2Cl)cc1OCc1ccncc1 |
| InChI | InChI=1S/C26H24ClN3O3/c1-17-4-5-18(2)30(17)21-7-8-23(27)22(15-21)26(31)29-20-6-9-24(32-3)25(14-20)33-16-19-10-12-28-13-11-19/h4-15H,16H2,1-3H3,(H,29,31) |
| InChIKey | FXTLMWRMBPJFIE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|