C24H31ClN4O2 — CID 24643670
2-[4-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 24643670) has the molecular formula C24H31ClN4O2 and a molecular weight of 442.99 g/mol. Its IUPAC name is 2-[4-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 24643670 |
| Molecular Formula | C24H31ClN4O2 |
| Molecular Weight | 442.99 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[4-[2-chloro-5-(2,5-dimethylpyrrol-1-yl)benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | Cc1ccc(C)n1-c1ccc(Cl)c(C(=O)N2CCN(CC(=O)N3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C24H31ClN4O2/c1-18-6-7-19(2)29(18)20-8-9-22(25)21(16-20)24(31)28-14-12-26(13-15-28)17-23(30)27-10-4-3-5-11-27/h6-9,16H,3-5,10-15,17H2,1-2H3 |
| InChIKey | VHHCLWVFENDIEZ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 48.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.99 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|