C12H20N4O3 — CID 18717725
2-[2-[3-(1-aminoethylideneamino)propyl]-1-methyl-3-oxo-2H-pyrazin-4-yl]acetic acid (PubChem CID 18717725) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[2-[3-(1-aminoethylideneamino)propyl]-1-methyl-3-oxo-2H-pyrazin-4-yl]acetic acid.
| Compound Name | 2-[2-[3-(1-aminoethylideneamino)propyl]-1-methyl-3-oxo-2H-pyrazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 18717725 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[2-[3-(1-aminoethylideneamino)propyl]-1-methyl-3-oxo-2H-pyrazin-4-yl]acetic acid |
| SMILES | C/C(N)=N\CCCC1C(=O)N(CC(=O)O)C=CN1C |
| InChI | InChI=1S/C12H20N4O3/c1-9(13)14-5-3-4-10-12(19)16(8-11(17)18)7-6-15(10)2/h6-7,10H,3-5,8H2,1-2H3,(H2,13,14)(H,17,18) |
| InChIKey | BPKDWSGDOPYORL-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|