C11H18N4O4 — CID 59883647
2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetic acid (PubChem CID 59883647) has the molecular formula C11H18N4O4 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetic acid.
| Compound Name | 2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59883647 |
| Molecular Formula | C11H18N4O4 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-[(3S)-3-[3-(1-aminoethylideneamino)propyl]-2,5-dioxopiperazin-1-yl]acetic acid |
| SMILES | C/C(N)=N\CCC[C@@H]1NC(=O)CN(CC(=O)O)C1=O |
| InChI | InChI=1S/C11H18N4O4/c1-7(12)13-4-2-3-8-11(19)15(6-10(17)18)5-9(16)14-8/h8H,2-6H2,1H3,(H2,12,13)(H,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | JOMBKQNKSLXFNN-QMMMGPOBSA-N |
| XLogP | -1.44 |
| TPSA | 125.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|