C12H20N4O3 — CID 18717754
N'-[3-[3,6-dioxo-4-(2-oxopropyl)piperazin-2-yl]propyl]ethanimidamide (PubChem CID 18717754) has the molecular formula C12H20N4O3 and a molecular weight of 268.32 g/mol. Its IUPAC name is N'-[3-[3,6-dioxo-4-(2-oxopropyl)piperazin-2-yl]propyl]ethanimidamide.
| Compound Name | N'-[3-[3,6-dioxo-4-(2-oxopropyl)piperazin-2-yl]propyl]ethanimidamide |
|---|---|
| PubChem CID | 18717754 |
| Molecular Formula | C12H20N4O3 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N'-[3-[3,6-dioxo-4-(2-oxopropyl)piperazin-2-yl]propyl]ethanimidamide |
| SMILES | CC(=O)CN1CC(=O)NC(CCC/N=C(\C)N)C1=O |
| InChI | InChI=1S/C12H20N4O3/c1-8(17)6-16-7-11(18)15-10(12(16)19)4-3-5-14-9(2)13/h10H,3-7H2,1-2H3,(H2,13,14)(H,15,18) |
| InChIKey | DLYFLRVTVRRLHG-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|