C8H15N5O2 — CID 188269
Cyclo(arginylglycyl) (PubChem CID 188269) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 2-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]guanidine.
| Compound Name | Cyclo(arginylglycyl) |
|---|---|
| PubChem CID | 188269 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 2-[3-[(2S)-3,6-dioxopiperazin-2-yl]propyl]guanidine |
| SMILES | C1C(=O)N[C@H](C(=O)N1)CCCN=C(N)N |
| InChI | InChI=1S/C8H15N5O2/c9-8(10)11-3-1-2-5-7(15)12-4-6(14)13-5/h5H,1-4H2,(H,12,15)(H,13,14)(H4,9,10,11)/t5-/m0/s1 |
| InChIKey | PNLUYLZSPGHNSN-YFKPBYRVSA-N |
| XLogP | -2.10 |
| TPSA | 123.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | 285 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|