C12H21NV — CID 18719741
N-(2,2,5,5-tetramethylhex-3-en-3-yl)ethanimine;vanadium(2+) (PubChem CID 18719741) has the molecular formula C12H21NV and a molecular weight of 230.25 g/mol. Its IUPAC name is N-(2,2,5,5-tetramethylhex-3-en-3-yl)ethanimine;vanadium(2+).
| Compound Name | N-(2,2,5,5-tetramethylhex-3-en-3-yl)ethanimine;vanadium(2+) |
|---|---|
| PubChem CID | 18719741 |
| Molecular Formula | C12H21NV |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | N-(2,2,5,5-tetramethylhex-3-en-3-yl)ethanimine;vanadium(2+) |
| SMILES | C/[C-]=N/C(=[C-]/C(C)(C)C)C(C)(C)C.[V+2] |
| InChI | InChI=1S/C12H21N.V/c1-8-13-10(12(5,6)7)9-11(2,3)4;/h1-7H3;/q-2;+2 |
| InChIKey | DWQDUKAUDKQSJK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|