C12H21NY-2 — CID 167377208
N-(4,4-dimethylpent-2-en-3-yl)-2,2-dimethylpropan-1-imine;yttrium (PubChem CID 167377208) has the molecular formula C12H21NY-2 and a molecular weight of 268.21 g/mol. Its IUPAC name is N-(4,4-dimethylpent-2-en-3-yl)-2,2-dimethylpropan-1-imine;yttrium.
| Compound Name | N-(4,4-dimethylpent-2-en-3-yl)-2,2-dimethylpropan-1-imine;yttrium |
|---|---|
| PubChem CID | 167377208 |
| Molecular Formula | C12H21NY-2 |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | N-(4,4-dimethylpent-2-en-3-yl)-2,2-dimethylpropan-1-imine;yttrium |
| SMILES | C/[C-]=C(/N=[C-]/C(C)(C)C)C(C)(C)C.[Y] |
| InChI | InChI=1S/C12H21N.Y/c1-8-10(12(5,6)7)13-9-11(2,3)4;/h1-7H3;/q-2; |
| InChIKey | FRELRCUZNKJOMK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|