C6H8NY- — CID 59009700
4,5-dimethyl-2,3-dihydropyrrol-2-ide;yttrium (PubChem CID 59009700) has the molecular formula C6H8NY- and a molecular weight of 183.04 g/mol. Its IUPAC name is 4,5-dimethyl-2,3-dihydropyrrol-2-ide;yttrium.
| Compound Name | 4,5-dimethyl-2,3-dihydropyrrol-2-ide;yttrium |
|---|---|
| PubChem CID | 59009700 |
| Molecular Formula | C6H8NY- |
| Molecular Weight | 183.04 g/mol |
| Exact Mass | 182.97 |
| IUPAC Name | 4,5-dimethyl-2,3-dihydropyrrol-2-ide;yttrium |
| SMILES | CC1=C(C)N=[C-]C1.[Y] |
| InChI | InChI=1S/C6H8N.Y/c1-5-3-4-7-6(5)2;/h3H2,1-2H3;/q-1; |
| InChIKey | FYFLMAPVTOBZQK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.04 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|