C8H15N — CID 161337167
methane;2,4,5-trimethyl-3H-pyrrole (PubChem CID 161337167) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is methane;2,4,5-trimethyl-3H-pyrrole.
| Compound Name | methane;2,4,5-trimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 161337167 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | methane;2,4,5-trimethyl-3H-pyrrole |
| SMILES | C.CC1=NC(C)=C(C)C1 |
| InChI | InChI=1S/C7H11N.CH4/c1-5-4-6(2)8-7(5)3;/h4H2,1-3H3;1H4 |
| InChIKey | VMELKWDYJDQBPX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |