About 9,9-dimethylcarbazol-9-ium
9,9-dimethylcarbazol-9-ium (PubChem CID 18721194) has the molecular formula C14H14N+
and a molecular weight of 196.27 g/mol. Its IUPAC name is 9,9-dimethylcarbazol-9-ium.
Molecular Properties
| Compound Name | 9,9-dimethylcarbazol-9-ium |
| PubChem CID | 18721194 |
| Molecular Formula | C14H14N+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 9,9-dimethylcarbazol-9-ium |
| SMILES | C[N+]1(C)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H14N/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10H,1-2H3/q+1 |
| InChIKey | DFNYLCBOICQHOG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethylcarbazol-9-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethylcarbazol-9-ium?
The IUPAC name of 9,9-dimethylcarbazol-9-ium (CID 18721194) is 9,9-dimethylcarbazol-9-ium.
What is the SMILES notation for 9,9-dimethylcarbazol-9-ium?
The canonical SMILES for 9,9-dimethylcarbazol-9-ium is C[N+]1(C)c2ccccc2-c2ccccc21.
What is the InChIKey of 9,9-dimethylcarbazol-9-ium?
The InChIKey is DFNYLCBOICQHOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N/c1-15(2)13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10H,1-2H3/q+1.
What are the key properties of 9,9-dimethylcarbazol-9-ium?
9,9-dimethylcarbazol-9-ium has a molecular weight of 196.27 g/mol, XLogP of 3.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethylcarbazol-9-ium is sourced from PubChem (CID 18721194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).